C23H33FO4 — CID 173478566
7-[(1S,3R)-2-[5-(4-fluorophenyl)-3-hydroxypent-4-enyl]-3-hydroxycyclopentyl]heptanoic acid (PubChem CID 173478566) has the molecular formula C23H33FO4 and a molecular weight of 392.51 g/mol. Its IUPAC name is 7-[(1S,3R)-2-[5-(4-fluorophenyl)-3-hydroxypent-4-enyl]-3-hydroxycyclopentyl]heptanoic acid.
| Compound Name | 7-[(1S,3R)-2-[5-(4-fluorophenyl)-3-hydroxypent-4-enyl]-3-hydroxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 173478566 |
| Molecular Formula | C23H33FO4 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | 7-[(1S,3R)-2-[5-(4-fluorophenyl)-3-hydroxypent-4-enyl]-3-hydroxycyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@H]1CC[C@@H](O)C1CCC(O)C=Cc1ccc(F)cc1 |
| InChI | InChI=1S/C23H33FO4/c24-19-11-7-17(8-12-19)9-13-20(25)14-15-21-18(10-16-22(21)26)5-3-1-2-4-6-23(27)28/h7-9,11-13,18,20-22,25-26H,1-6,10,14-16H2,(H,27,28)/t18-,20?,21?,22+/m0/s1 |
| InChIKey | PUPYRTWPMGIDBW-FTWXPCQCSA-N |
| XLogP | 4.79 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|