C25H37F2NO3 — CID 91173912
7-[2-[7-(2,4-difluoroanilino)-3-hydroxyhept-4-enyl]cyclopentyl]heptanoic acid (PubChem CID 91173912) has the molecular formula C25H37F2NO3 and a molecular weight of 437.57 g/mol. Its IUPAC name is 7-[2-[7-(2,4-difluoroanilino)-3-hydroxyhept-4-enyl]cyclopentyl]heptanoic acid.
| Compound Name | 7-[2-[7-(2,4-difluoroanilino)-3-hydroxyhept-4-enyl]cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 91173912 |
| Molecular Formula | C25H37F2NO3 |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | 7-[2-[7-(2,4-difluoroanilino)-3-hydroxyhept-4-enyl]cyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCCC1CCCC1CCC(O)C=CCCNc1ccc(F)cc1F |
| InChI | InChI=1S/C25H37F2NO3/c26-21-14-16-24(23(27)18-21)28-17-6-5-11-22(29)15-13-20-10-7-9-19(20)8-3-1-2-4-12-25(30)31/h5,11,14,16,18-20,22,28-29H,1-4,6-10,12-13,15,17H2,(H,30,31) |
| InChIKey | QRQRCBPBAJKCNL-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|