C22H33ClN2O3 — CID 142015642
7-[(1S,2R)-2-[4-(3-chlorophenyl)imino-3-hydroxybutyl]cyclopentyl]-N-hydroxyheptanamide (PubChem CID 142015642) has the molecular formula C22H33ClN2O3 and a molecular weight of 408.97 g/mol. Its IUPAC name is 7-[(1S,2R)-2-[4-(3-chlorophenyl)imino-3-hydroxybutyl]cyclopentyl]-N-hydroxyheptanamide.
| Compound Name | 7-[(1S,2R)-2-[4-(3-chlorophenyl)imino-3-hydroxybutyl]cyclopentyl]-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 142015642 |
| Molecular Formula | C22H33ClN2O3 |
| Molecular Weight | 408.97 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 7-[(1S,2R)-2-[4-(3-chlorophenyl)imino-3-hydroxybutyl]cyclopentyl]-N-hydroxyheptanamide |
| SMILES | O=C(CCCCCC[C@H]1CCC[C@@H]1CCC(O)/C=N/c1cccc(Cl)c1)NO |
| InChI | InChI=1S/C22H33ClN2O3/c23-19-10-6-11-20(15-19)24-16-21(26)14-13-18-9-5-8-17(18)7-3-1-2-4-12-22(27)25-28/h6,10-11,15-18,21,26,28H,1-5,7-9,12-14H2,(H,25,27)/b24-16+/t17-,18+,21?/m0/s1 |
| InChIKey | KVWMUSPMJMBKDD-NABAAAKTSA-N |
| XLogP | 5.45 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.97 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|