C22H33ClN2O5 — CID 90834609
7-[(1R,2R,3R,5S)-2-[4-(3-chloroanilino)-3-oxobutyl]-3,5-dihydroxycyclopentyl]-N-hydroxyheptanamide (PubChem CID 90834609) has the molecular formula C22H33ClN2O5 and a molecular weight of 440.97 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-2-[4-(3-chloroanilino)-3-oxobutyl]-3,5-dihydroxycyclopentyl]-N-hydroxyheptanamide.
| Compound Name | 7-[(1R,2R,3R,5S)-2-[4-(3-chloroanilino)-3-oxobutyl]-3,5-dihydroxycyclopentyl]-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 90834609 |
| Molecular Formula | C22H33ClN2O5 |
| Molecular Weight | 440.97 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-2-[4-(3-chloroanilino)-3-oxobutyl]-3,5-dihydroxycyclopentyl]-N-hydroxyheptanamide |
| SMILES | O=C(CC[C@@H]1[C@@H](CCCCCCC(=O)NO)[C@@H](O)C[C@H]1O)CNc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H33ClN2O5/c23-15-6-5-7-16(12-15)24-14-17(26)10-11-19-18(20(27)13-21(19)28)8-3-1-2-4-9-22(29)25-30/h5-7,12,18-21,24,27-28,30H,1-4,8-11,13-14H2,(H,25,29)/t18-,19-,20+,21-/m1/s1 |
| InChIKey | SUBIUKAXCLBXBT-MXEMCNAFSA-N |
| XLogP | 3.31 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.97 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|