C16H19ClN4O3S — CID 142729813
N-[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]-N'-hydroxyoctanediamide (PubChem CID 142729813) has the molecular formula C16H19ClN4O3S and a molecular weight of 382.87 g/mol. Its IUPAC name is N-[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]-N'-hydroxyoctanediamide.
| Compound Name | N-[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 142729813 |
| Molecular Formula | C16H19ClN4O3S |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | N-[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]-N'-hydroxyoctanediamide |
| SMILES | O=C(CCCCCCC(=O)Nc1nnc(-c2cccc(Cl)c2)s1)NO |
| InChI | InChI=1S/C16H19ClN4O3S/c17-12-7-5-6-11(10-12)15-19-20-16(25-15)18-13(22)8-3-1-2-4-9-14(23)21-24/h5-7,10,24H,1-4,8-9H2,(H,21,23)(H,18,20,22) |
| InChIKey | VUCYOAAHDKFVNG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|