C15H19N5O3S — CID 118716313
N'-hydroxy-N-(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)octanediamide (PubChem CID 118716313) has the molecular formula C15H19N5O3S and a molecular weight of 349.42 g/mol. Its IUPAC name is N'-hydroxy-N-(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)octanediamide.
| Compound Name | N'-hydroxy-N-(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)octanediamide |
|---|---|
| PubChem CID | 118716313 |
| Molecular Formula | C15H19N5O3S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | N'-hydroxy-N-(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)octanediamide |
| SMILES | O=C(CCCCCCC(=O)Nc1nnc(-c2cccnc2)s1)NO |
| InChI | InChI=1S/C15H19N5O3S/c21-12(7-3-1-2-4-8-13(22)20-23)17-15-19-18-14(24-15)11-6-5-9-16-10-11/h5-6,9-10,23H,1-4,7-8H2,(H,20,22)(H,17,19,21) |
| InChIKey | UATXVOCQHGXRFA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|