C11H11ClN4OS — CID 66634960
4-chloro-N-(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 66634960) has the molecular formula C11H11ClN4OS and a molecular weight of 282.76 g/mol. Its IUPAC name is 4-chloro-N-(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | 4-chloro-N-(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 66634960 |
| Molecular Formula | C11H11ClN4OS |
| Molecular Weight | 282.76 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 4-chloro-N-(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | O=C(CCCCl)Nc1nnc(-c2cccnc2)s1 |
| InChI | InChI=1S/C11H11ClN4OS/c12-5-1-4-9(17)14-11-16-15-10(18-11)8-3-2-6-13-7-8/h2-3,6-7H,1,4-5H2,(H,14,16,17) |
| InChIKey | VVAXTUCFVOXJGG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.76 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|