C23H25ClN4O2S — CID 92961246
N-[(2S)-1-[[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]hexanamide (PubChem CID 92961246) has the molecular formula C23H25ClN4O2S and a molecular weight of 457.00 g/mol. Its IUPAC name is N-[(2S)-1-[[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]hexanamide.
| Compound Name | N-[(2S)-1-[[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]hexanamide |
|---|---|
| PubChem CID | 92961246 |
| Molecular Formula | C23H25ClN4O2S |
| Molecular Weight | 457.00 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | N-[(2S)-1-[[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]hexanamide |
| SMILES | CCCCCC(=O)N[C@@H](Cc1ccccc1)C(=O)Nc1nnc(-c2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C23H25ClN4O2S/c1-2-3-5-13-20(29)25-19(14-16-9-6-4-7-10-16)21(30)26-23-28-27-22(31-23)17-11-8-12-18(24)15-17/h4,6-12,15,19H,2-3,5,13-14H2,1H3,(H,25,29)(H,26,28,30)/t19-/m0/s1 |
| InChIKey | RWIWTLXHDXHTQT-IBGZPJMESA-N |
| XLogP | 5.10 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.00 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|