C22H25N5O2S — CID 42757921
2-(butylcarbamoylamino)-3-phenyl-N-(5-phenyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 42757921) has the molecular formula C22H25N5O2S and a molecular weight of 423.54 g/mol. Its IUPAC name is 2-(butylcarbamoylamino)-3-phenyl-N-(5-phenyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 2-(butylcarbamoylamino)-3-phenyl-N-(5-phenyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 42757921 |
| Molecular Formula | C22H25N5O2S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 2-(butylcarbamoylamino)-3-phenyl-N-(5-phenyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | CCCCNC(=O)NC(Cc1ccccc1)C(=O)Nc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C22H25N5O2S/c1-2-3-14-23-21(29)24-18(15-16-10-6-4-7-11-16)19(28)25-22-27-26-20(30-22)17-12-8-5-9-13-17/h4-13,18H,2-3,14-15H2,1H3,(H2,23,24,29)(H,25,27,28) |
| InChIKey | SBODCQIIXFWRNE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|