C18H25N5O2S — CID 7361360
(2S)-2-(butylcarbamoylamino)-3-methyl-N-(5-phenyl-1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 7361360) has the molecular formula C18H25N5O2S and a molecular weight of 375.50 g/mol. Its IUPAC name is (2S)-2-(butylcarbamoylamino)-3-methyl-N-(5-phenyl-1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | (2S)-2-(butylcarbamoylamino)-3-methyl-N-(5-phenyl-1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 7361360 |
| Molecular Formula | C18H25N5O2S |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | (2S)-2-(butylcarbamoylamino)-3-methyl-N-(5-phenyl-1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | CCCCNC(=O)N[C@H](C(=O)Nc1nnc(-c2ccccc2)s1)C(C)C |
| InChI | InChI=1S/C18H25N5O2S/c1-4-5-11-19-17(25)20-14(12(2)3)15(24)21-18-23-22-16(26-18)13-9-7-6-8-10-13/h6-10,12,14H,4-5,11H2,1-3H3,(H2,19,20,25)(H,21,23,24)/t14-/m0/s1 |
| InChIKey | RQPGMJNGUJJPBJ-AWEZNQCLSA-N |
| XLogP | 3.27 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|