C26H27ClN4O2S — CID 3517504
N-[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]-3-[cyclohexyl(3-phenylprop-2-enoyl)amino]propanamide (PubChem CID 3517504) has the molecular formula C26H27ClN4O2S and a molecular weight of 495.05 g/mol. Its IUPAC name is N-[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]-3-[cyclohexyl(3-phenylprop-2-enoyl)amino]propanamide.
| Compound Name | N-[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]-3-[cyclohexyl(3-phenylprop-2-enoyl)amino]propanamide |
|---|---|
| PubChem CID | 3517504 |
| Molecular Formula | C26H27ClN4O2S |
| Molecular Weight | 495.05 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | N-[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]-3-[cyclohexyl(3-phenylprop-2-enoyl)amino]propanamide |
| SMILES | O=C(CCN(C(=O)C=Cc1ccccc1)C1CCCCC1)Nc1nnc(-c2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C26H27ClN4O2S/c27-21-11-7-10-20(18-21)25-29-30-26(34-25)28-23(32)16-17-31(22-12-5-2-6-13-22)24(33)15-14-19-8-3-1-4-9-19/h1,3-4,7-11,14-15,18,22H,2,5-6,12-13,16-17H2,(H,28,30,32) |
| InChIKey | HQUWGHGXIXHRLQ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.05 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|