C27H39FO5S — CID 54565464
methyl 2-[(4-fluorophenyl)methyl]-7-[(1S,2R)-3-hydroxy-2-(2-hydroxyheptylsulfanyl)-5-oxocyclopentyl]hept-5-enoate (PubChem CID 54565464) has the molecular formula C27H39FO5S and a molecular weight of 494.67 g/mol. Its IUPAC name is methyl 2-[(4-fluorophenyl)methyl]-7-[(1S,2R)-3-hydroxy-2-(2-hydroxyheptylsulfanyl)-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | methyl 2-[(4-fluorophenyl)methyl]-7-[(1S,2R)-3-hydroxy-2-(2-hydroxyheptylsulfanyl)-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 54565464 |
| Molecular Formula | C27H39FO5S |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | methyl 2-[(4-fluorophenyl)methyl]-7-[(1S,2R)-3-hydroxy-2-(2-hydroxyheptylsulfanyl)-5-oxocyclopentyl]hept-5-enoate |
| SMILES | CCCCCC(O)CS[C@H]1C(O)CC(=O)[C@@H]1CC=CCCC(Cc1ccc(F)cc1)C(=O)OC |
| InChI | InChI=1S/C27H39FO5S/c1-3-4-6-10-22(29)18-34-26-23(24(30)17-25(26)31)11-8-5-7-9-20(27(32)33-2)16-19-12-14-21(28)15-13-19/h5,8,12-15,20,22-23,25-26,29,31H,3-4,6-7,9-11,16-18H2,1-2H3/t20?,22?,23-,25?,26+/m0/s1 |
| InChIKey | ZTMVYJDNCIRDHP-VPZRFOKMSA-N |
| XLogP | 4.88 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|