C18H32O4 — CID 58882391
deuteriomethyl 7-(3-hydroxy-5-oxo-2-pentylcyclopentyl)heptanoate (PubChem CID 58882391) has the molecular formula C18H32O4 and a molecular weight of 313.46 g/mol. Its IUPAC name is deuteriomethyl 7-(3-hydroxy-5-oxo-2-pentylcyclopentyl)heptanoate.
| Compound Name | deuteriomethyl 7-(3-hydroxy-5-oxo-2-pentylcyclopentyl)heptanoate |
|---|---|
| PubChem CID | 58882391 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | deuteriomethyl 7-(3-hydroxy-5-oxo-2-pentylcyclopentyl)heptanoate |
| SMILES | [2H]COC(=O)CCCCCCC1C(=O)CC(O)C1CCCCC |
| InChI | InChI=1S/C18H32O4/c1-3-4-7-10-14-15(17(20)13-16(14)19)11-8-5-6-9-12-18(21)22-2/h14-16,19H,3-13H2,1-2H3/i2D |
| InChIKey | AGPIJELBPCAZHD-VMNATFBRSA-N |
| XLogP | 3.65 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|