C29H56O10 — CID 90799701
ethane;2-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl 7-(3-hydroxy-5-oxo-2-pentylcyclopentyl)heptanoate (PubChem CID 90799701) has the molecular formula C29H56O10 and a molecular weight of 564.76 g/mol. Its IUPAC name is ethane;2-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl 7-(3-hydroxy-5-oxo-2-pentylcyclopentyl)heptanoate.
| Compound Name | ethane;2-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl 7-(3-hydroxy-5-oxo-2-pentylcyclopentyl)heptanoate |
|---|---|
| PubChem CID | 90799701 |
| Molecular Formula | C29H56O10 |
| Molecular Weight | 564.76 g/mol |
| Exact Mass | 564.39 |
| IUPAC Name | ethane;2-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl 7-(3-hydroxy-5-oxo-2-pentylcyclopentyl)heptanoate |
| SMILES | CC.CC.CCCCCC1C(O)CC(=O)C1CCCCCCC(=O)OCCOC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H44O10.2C2H6/c1-2-3-6-9-16-17(19(28)14-18(16)27)10-7-4-5-8-11-21(29)33-12-13-34-25-24(32)23(31)22(30)20(15-26)35-25;2*1-2/h16-18,20,22-27,30-32H,2-15H2,1H3;2*1-2H3/t16?,17?,18?,20-,22-,23+,24-,25?;;/m1../s1 |
| InChIKey | MFWSDPILRNYKQL-PRBIBRESSA-N |
| XLogP | 2.89 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.76 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|