C23H40O9 — CID 58882422
7-[5-oxo-2-pentyl-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclopentyl]heptanoic acid (PubChem CID 58882422) has the molecular formula C23H40O9 and a molecular weight of 460.56 g/mol. Its IUPAC name is 7-[5-oxo-2-pentyl-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclopentyl]heptanoic acid.
| Compound Name | 7-[5-oxo-2-pentyl-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 58882422 |
| Molecular Formula | C23H40O9 |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | 7-[5-oxo-2-pentyl-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclopentyl]heptanoic acid |
| SMILES | CCCCCC1C(OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)CC(=O)C1CCCCCCC(=O)O |
| InChI | InChI=1S/C23H40O9/c1-2-3-6-10-15-14(9-7-4-5-8-11-19(26)27)16(25)12-17(15)31-23-22(30)21(29)20(28)18(13-24)32-23/h14-15,17-18,20-24,28-30H,2-13H2,1H3,(H,26,27)/t14?,15?,17?,18-,20-,21+,22-,23?/m1/s1 |
| InChIKey | AUWLQUACLMLTQB-OCCFXVNTSA-N |
| XLogP | 1.38 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|