C23H38O10 — CID 58882402
(2S,3S,4S,5R)-3,4,5-trihydroxy-6-[7-(3-hydroxy-5-oxo-2-pentylcyclopentyl)heptanoyloxy]oxane-2-carboxylic acid (PubChem CID 58882402) has the molecular formula C23H38O10 and a molecular weight of 474.55 g/mol. Its IUPAC name is (2S,3S,4S,5R)-3,4,5-trihydroxy-6-[7-(3-hydroxy-5-oxo-2-pentylcyclopentyl)heptanoyloxy]oxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R)-3,4,5-trihydroxy-6-[7-(3-hydroxy-5-oxo-2-pentylcyclopentyl)heptanoyloxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 58882402 |
| Molecular Formula | C23H38O10 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | (2S,3S,4S,5R)-3,4,5-trihydroxy-6-[7-(3-hydroxy-5-oxo-2-pentylcyclopentyl)heptanoyloxy]oxane-2-carboxylic acid |
| SMILES | CCCCCC1C(O)CC(=O)C1CCCCCCC(=O)OC1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C23H38O10/c1-2-3-6-9-13-14(16(25)12-15(13)24)10-7-4-5-8-11-17(26)32-23-20(29)18(27)19(28)21(33-23)22(30)31/h13-15,18-21,23-24,27-29H,2-12H2,1H3,(H,30,31)/t13?,14?,15?,18-,19-,20+,21-,23?/m0/s1 |
| InChIKey | IFJBDBCAQDWXAR-JFIVGMDHSA-N |
| XLogP | 0.91 |
| TPSA | 170.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|