C20H30O2 — CID 58180279
2-heptyl-4-hydroxy-3-(2-phenylethyl)cyclopentan-1-one (PubChem CID 58180279) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 2-heptyl-4-hydroxy-3-(2-phenylethyl)cyclopentan-1-one.
| Compound Name | 2-heptyl-4-hydroxy-3-(2-phenylethyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 58180279 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 2-heptyl-4-hydroxy-3-(2-phenylethyl)cyclopentan-1-one |
| SMILES | CCCCCCCC1C(=O)CC(O)C1CCc1ccccc1 |
| InChI | InChI=1S/C20H30O2/c1-2-3-4-5-9-12-17-18(20(22)15-19(17)21)14-13-16-10-7-6-8-11-16/h6-8,10-11,17-18,20,22H,2-5,9,12-15H2,1H3 |
| InChIKey | SVJLZBUUWGTDCW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|