C20H34O4S — CID 10451829
methyl 7-[(1R,2S,3R)-3-hydroxy-5-oxo-2-[(E)-2-pentylsulfanylethenyl]cyclopentyl]heptanoate (PubChem CID 10451829) has the molecular formula C20H34O4S and a molecular weight of 370.56 g/mol. Its IUPAC name is methyl 7-[(1R,2S,3R)-3-hydroxy-5-oxo-2-[(E)-2-pentylsulfanylethenyl]cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2S,3R)-3-hydroxy-5-oxo-2-[(E)-2-pentylsulfanylethenyl]cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 10451829 |
| Molecular Formula | C20H34O4S |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | methyl 7-[(1R,2S,3R)-3-hydroxy-5-oxo-2-[(E)-2-pentylsulfanylethenyl]cyclopentyl]heptanoate |
| SMILES | CCCCCS/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(=O)OC |
| InChI | InChI=1S/C20H34O4S/c1-3-4-9-13-25-14-12-17-16(18(21)15-19(17)22)10-7-5-6-8-11-20(23)24-2/h12,14,16-17,19,22H,3-11,13,15H2,1-2H3/b14-12+/t16-,17-,19-/m1/s1 |
| InChIKey | LLDBNLPONUZRKI-WOXJAZAKSA-N |
| XLogP | 4.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|