C21H32O — CID 170769500
(2S)-1-cyclobutyl-5-methyl-2-phenyldecan-1-one (PubChem CID 170769500) has the molecular formula C21H32O and a molecular weight of 300.49 g/mol. Its IUPAC name is (2S)-1-cyclobutyl-5-methyl-2-phenyldecan-1-one.
| Compound Name | (2S)-1-cyclobutyl-5-methyl-2-phenyldecan-1-one |
|---|---|
| PubChem CID | 170769500 |
| Molecular Formula | C21H32O |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | (2S)-1-cyclobutyl-5-methyl-2-phenyldecan-1-one |
| SMILES | CCCCCC(C)CC[C@H](C(=O)C1CCC1)c1ccccc1 |
| InChI | InChI=1S/C21H32O/c1-3-4-6-10-17(2)15-16-20(18-11-7-5-8-12-18)21(22)19-13-9-14-19/h5,7-8,11-12,17,19-20H,3-4,6,9-10,13-16H2,1-2H3/t17?,20-/m0/s1 |
| InChIKey | ARDYIESATLJODO-OZBJMMHXSA-N |
| XLogP | 6.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|