C23H40 — CID 142894484
(2R)-1-[(E)-4,4-dimethyloct-1-enyl]-2-[(Z)-hept-2-enyl]-3-methylidenecyclopentane (PubChem CID 142894484) has the molecular formula C23H40 and a molecular weight of 316.57 g/mol. Its IUPAC name is (2R)-1-[(E)-4,4-dimethyloct-1-enyl]-2-[(Z)-hept-2-enyl]-3-methylidenecyclopentane.
| Compound Name | (2R)-1-[(E)-4,4-dimethyloct-1-enyl]-2-[(Z)-hept-2-enyl]-3-methylidenecyclopentane |
|---|---|
| PubChem CID | 142894484 |
| Molecular Formula | C23H40 |
| Molecular Weight | 316.57 g/mol |
| Exact Mass | 316.31 |
| IUPAC Name | (2R)-1-[(E)-4,4-dimethyloct-1-enyl]-2-[(Z)-hept-2-enyl]-3-methylidenecyclopentane |
| SMILES | C=C1CCC(/C=C/CC(C)(C)CCCC)[C@H]1C/C=C\CCCC |
| InChI | InChI=1S/C23H40/c1-6-8-10-11-12-15-22-20(3)16-17-21(22)14-13-19-23(4,5)18-9-7-2/h11-14,21-22H,3,6-10,15-19H2,1-2,4-5H3/b12-11-,14-13+/t21?,22-/m0/s1 |
| InChIKey | QXOISDDDZAMCAO-MMZSLJGRSA-N |
| XLogP | 7.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.57 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|