C17H30O — CID 142894506
(E)-3-[(2R)-3-methylidene-2-octylcyclopentyl]prop-2-en-1-ol (PubChem CID 142894506) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is (E)-3-[(2R)-3-methylidene-2-octylcyclopentyl]prop-2-en-1-ol.
| Compound Name | (E)-3-[(2R)-3-methylidene-2-octylcyclopentyl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 142894506 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | (E)-3-[(2R)-3-methylidene-2-octylcyclopentyl]prop-2-en-1-ol |
| SMILES | C=C1CCC(/C=C/CO)[C@H]1CCCCCCCC |
| InChI | InChI=1S/C17H30O/c1-3-4-5-6-7-8-11-17-15(2)12-13-16(17)10-9-14-18/h9-10,16-18H,2-8,11-14H2,1H3/b10-9+/t16?,17-/m0/s1 |
| InChIKey | KBKUMPMEKQXWNR-RUEVOVDXSA-N |
| XLogP | 4.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|