C24H44O — CID 142514711
1-[(E)-4,4-dimethyloct-1-enyl]-3-methylidenecyclopentane;octan-2-one (PubChem CID 142514711) has the molecular formula C24H44O and a molecular weight of 348.62 g/mol. Its IUPAC name is 1-[(E)-4,4-dimethyloct-1-enyl]-3-methylidenecyclopentane;octan-2-one.
| Compound Name | 1-[(E)-4,4-dimethyloct-1-enyl]-3-methylidenecyclopentane;octan-2-one |
|---|---|
| PubChem CID | 142514711 |
| Molecular Formula | C24H44O |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 348.34 |
| IUPAC Name | 1-[(E)-4,4-dimethyloct-1-enyl]-3-methylidenecyclopentane;octan-2-one |
| SMILES | C=C1CCC(/C=C/CC(C)(C)CCCC)C1.CCCCCCC(C)=O |
| InChI | InChI=1S/C16H28.C8H16O/c1-5-6-11-16(3,4)12-7-8-15-10-9-14(2)13-15;1-3-4-5-6-7-8(2)9/h7-8,15H,2,5-6,9-13H2,1,3-4H3;3-7H2,1-2H3/b8-7+; |
| InChIKey | CYWMPNNGZFGKPH-USRGLUTNSA-N |
| XLogP | 8.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|