C23H36O4 — CID 70613024
7-[(1R,2R)-2-[(E)-4-cyclohex-3-en-1-yl-3-hydroxy-3-methylbut-1-enyl]-5-oxocyclopentyl]heptanoic acid (PubChem CID 70613024) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is 7-[(1R,2R)-2-[(E)-4-cyclohex-3-en-1-yl-3-hydroxy-3-methylbut-1-enyl]-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R)-2-[(E)-4-cyclohex-3-en-1-yl-3-hydroxy-3-methylbut-1-enyl]-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 70613024 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | 7-[(1R,2R)-2-[(E)-4-cyclohex-3-en-1-yl-3-hydroxy-3-methylbut-1-enyl]-5-oxocyclopentyl]heptanoic acid |
| SMILES | CC(O)(/C=C/[C@H]1CCC(=O)[C@@H]1CCCCCCC(=O)O)CC1CC=CCC1 |
| InChI | InChI=1S/C23H36O4/c1-23(27,17-18-9-5-4-6-10-18)16-15-19-13-14-21(24)20(19)11-7-2-3-8-12-22(25)26/h4-5,15-16,18-20,27H,2-3,6-14,17H2,1H3,(H,25,26)/b16-15+/t18?,19-,20-,23?/m1/s1 |
| InChIKey | SWASBIQCBAPUHB-XVQQEEKPSA-N |
| XLogP | 5.06 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|