C27H46O6 — CID 57140559
ethyl 2-ethyl-3-hydroxy-2-(3-hydroxypropoxy)-7-[(1R,2R)-2-octa-1,5-dienyl-5-oxocyclopentyl]heptanoate (PubChem CID 57140559) has the molecular formula C27H46O6 and a molecular weight of 466.66 g/mol. Its IUPAC name is ethyl 2-ethyl-3-hydroxy-2-(3-hydroxypropoxy)-7-[(1R,2R)-2-octa-1,5-dienyl-5-oxocyclopentyl]heptanoate.
| Compound Name | ethyl 2-ethyl-3-hydroxy-2-(3-hydroxypropoxy)-7-[(1R,2R)-2-octa-1,5-dienyl-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 57140559 |
| Molecular Formula | C27H46O6 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.33 |
| IUPAC Name | ethyl 2-ethyl-3-hydroxy-2-(3-hydroxypropoxy)-7-[(1R,2R)-2-octa-1,5-dienyl-5-oxocyclopentyl]heptanoate |
| SMILES | CCC=CCCC=C[C@H]1CCC(=O)[C@@H]1CCCCC(O)C(CC)(OCCCO)C(=O)OCC |
| InChI | InChI=1S/C27H46O6/c1-4-7-8-9-10-11-15-22-18-19-24(29)23(22)16-12-13-17-25(30)27(5-2,26(31)32-6-3)33-21-14-20-28/h7-8,11,15,22-23,25,28,30H,4-6,9-10,12-14,16-21H2,1-3H3/t22-,23+,25?,27?/m0/s1 |
| InChIKey | DICKUIWNQDJCPA-TVXBQVBBSA-N |
| XLogP | 4.92 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|