C18H29NO5 — CID 23653746
acetic acid;3-[(1R,2R,3S)-3-hydroxy-2-[(E)-8-hydroxyoct-1-enyl]-5-oxocyclopentyl]propanenitrile (PubChem CID 23653746) has the molecular formula C18H29NO5 and a molecular weight of 339.43 g/mol. Its IUPAC name is acetic acid;3-[(1R,2R,3S)-3-hydroxy-2-[(E)-8-hydroxyoct-1-enyl]-5-oxocyclopentyl]propanenitrile.
| Compound Name | acetic acid;3-[(1R,2R,3S)-3-hydroxy-2-[(E)-8-hydroxyoct-1-enyl]-5-oxocyclopentyl]propanenitrile |
|---|---|
| PubChem CID | 23653746 |
| Molecular Formula | C18H29NO5 |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | acetic acid;3-[(1R,2R,3S)-3-hydroxy-2-[(E)-8-hydroxyoct-1-enyl]-5-oxocyclopentyl]propanenitrile |
| SMILES | CC(=O)O.N#CCC[C@H]1C(=O)C[C@H](O)[C@@H]1/C=C/CCCCCCO |
| InChI | InChI=1S/C16H25NO3.C2H4O2/c17-10-7-9-14-13(15(19)12-16(14)20)8-5-3-1-2-4-6-11-18;1-2(3)4/h5,8,13-15,18-19H,1-4,6-7,9,11-12H2;1H3,(H,3,4)/b8-5+;/t13-,14-,15+;/m1./s1 |
| InChIKey | HDGWYZXVFXKERY-GKNDWUTJSA-N |
| XLogP | 2.45 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|