C21H37NO2S — CID 70624366
7-[(2R,3S,4S)-4-hydroxy-3-(10-hydroxydec-1-enyl)thiolan-2-yl]heptanenitrile (PubChem CID 70624366) has the molecular formula C21H37NO2S and a molecular weight of 367.60 g/mol. Its IUPAC name is 7-[(2R,3S,4S)-4-hydroxy-3-(10-hydroxydec-1-enyl)thiolan-2-yl]heptanenitrile.
| Compound Name | 7-[(2R,3S,4S)-4-hydroxy-3-(10-hydroxydec-1-enyl)thiolan-2-yl]heptanenitrile |
|---|---|
| PubChem CID | 70624366 |
| Molecular Formula | C21H37NO2S |
| Molecular Weight | 367.60 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | 7-[(2R,3S,4S)-4-hydroxy-3-(10-hydroxydec-1-enyl)thiolan-2-yl]heptanenitrile |
| SMILES | N#CCCCCCC[C@H]1SC[C@@H](O)[C@@H]1C=CCCCCCCCCO |
| InChI | InChI=1S/C21H37NO2S/c22-16-12-8-5-7-11-15-21-19(20(24)18-25-21)14-10-6-3-1-2-4-9-13-17-23/h10,14,19-21,23-24H,1-9,11-13,15,17-18H2/t19-,20+,21+/m0/s1 |
| InChIKey | CMBUMRWDOHISPK-PWRODBHTSA-N |
| XLogP | 5.22 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.60 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|