C9H20N2OS — CID 151296817
5-[(2S,3S,4R)-3,4-diaminothiolan-2-yl]pentan-1-ol (PubChem CID 151296817) has the molecular formula C9H20N2OS and a molecular weight of 204.34 g/mol. Its IUPAC name is 5-[(2S,3S,4R)-3,4-diaminothiolan-2-yl]pentan-1-ol.
| Compound Name | 5-[(2S,3S,4R)-3,4-diaminothiolan-2-yl]pentan-1-ol |
|---|---|
| PubChem CID | 151296817 |
| Molecular Formula | C9H20N2OS |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 5-[(2S,3S,4R)-3,4-diaminothiolan-2-yl]pentan-1-ol |
| SMILES | N[C@@H]1[C@H](CCCCCO)SC[C@@H]1N |
| InChI | InChI=1S/C9H20N2OS/c10-7-6-13-8(9(7)11)4-2-1-3-5-12/h7-9,12H,1-6,10-11H2/t7-,8-,9-/m0/s1 |
| InChIKey | OBOQMRWEIOXMGM-CIUDSAMLSA-N |
| XLogP | 0.31 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|