C9H19NO3 — CID 45380291
(2R,3R,4R)-2-(5-hydroxypentyl)pyrrolidine-3,4-diol (PubChem CID 45380291) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is (2R,3R,4R)-2-(5-hydroxypentyl)pyrrolidine-3,4-diol.
| Compound Name | (2R,3R,4R)-2-(5-hydroxypentyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 45380291 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | (2R,3R,4R)-2-(5-hydroxypentyl)pyrrolidine-3,4-diol |
| SMILES | OCCCCC[C@H]1NC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H19NO3/c11-5-3-1-2-4-7-9(13)8(12)6-10-7/h7-13H,1-6H2/t7-,8-,9-/m1/s1 |
| InChIKey | DMBZHMCCQNYVGU-IWSPIJDZSA-N |
| XLogP | -0.77 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|