About 2-(hydroxymethyl)piperidine-3,4,5-triol;tungsten
2-(hydroxymethyl)piperidine-3,4,5-triol;tungsten (PubChem CID 140623793) has the molecular formula C6H13NO4W10
and a molecular weight of 2001.57 g/mol. Its IUPAC name is 2-(hydroxymethyl)piperidine-3,4,5-triol;tungsten.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)piperidine-3,4,5-triol;tungsten |
| PubChem CID | 140623793 |
| Molecular Formula | C6H13NO4W10 |
| Molecular Weight | 2001.57 g/mol |
| Exact Mass | 2002.59 |
| IUPAC Name | 2-(hydroxymethyl)piperidine-3,4,5-triol;tungsten |
| SMILES | OCC1NCC(O)C(O)C1O.[W].[W].[W].[W].[W].[W].[W].[W].[W].[W] |
| InChI | InChI=1S/C6H13NO4.10W/c8-2-3-5(10)6(11)4(9)1-7-3;;;;;;;;;;/h3-11H,1-2H2;;;;;;;;;; |
| InChIKey | DLOIDTBIYHCIJB-UHFFFAOYSA-N |
| XLogP | -2.99 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 2001.57 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(hydroxymethyl)piperidine-3,4,5-triol;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)piperidine-3,4,5-triol;tungsten?
The IUPAC name of 2-(hydroxymethyl)piperidine-3,4,5-triol;tungsten (CID 140623793) is 2-(hydroxymethyl)piperidine-3,4,5-triol;tungsten.
What is the SMILES notation for 2-(hydroxymethyl)piperidine-3,4,5-triol;tungsten?
The canonical SMILES for 2-(hydroxymethyl)piperidine-3,4,5-triol;tungsten is OCC1NCC(O)C(O)C1O.[W].[W].[W].[W].[W].[W].[W].[W].[W].[W].
What is the InChIKey of 2-(hydroxymethyl)piperidine-3,4,5-triol;tungsten?
The InChIKey is DLOIDTBIYHCIJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO4.10W/c8-2-3-5(10)6(11)4(9)1-7-3;;;;;;;;;;/h3-11H,1-2H2;;;;;;;;;;.
What are the key properties of 2-(hydroxymethyl)piperidine-3,4,5-triol;tungsten?
2-(hydroxymethyl)piperidine-3,4,5-triol;tungsten has a molecular weight of 2001.57 g/mol, XLogP of -2.99, 1 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)piperidine-3,4,5-triol;tungsten is sourced from PubChem (CID 140623793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).