C19H28O6 — CID 54093312
7-[(1R,2R)-3-hydroxy-2-(3-hydroxyhept-1-enyl)-5-oxocyclopentyl]-6-oxohept-2-enoic acid (PubChem CID 54093312) has the molecular formula C19H28O6 and a molecular weight of 352.43 g/mol. Its IUPAC name is 7-[(1R,2R)-3-hydroxy-2-(3-hydroxyhept-1-enyl)-5-oxocyclopentyl]-6-oxohept-2-enoic acid.
| Compound Name | 7-[(1R,2R)-3-hydroxy-2-(3-hydroxyhept-1-enyl)-5-oxocyclopentyl]-6-oxohept-2-enoic acid |
|---|---|
| PubChem CID | 54093312 |
| Molecular Formula | C19H28O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 7-[(1R,2R)-3-hydroxy-2-(3-hydroxyhept-1-enyl)-5-oxocyclopentyl]-6-oxohept-2-enoic acid |
| SMILES | CCCCC(O)C=C[C@H]1C(O)CC(=O)[C@@H]1CC(=O)CCC=CC(=O)O |
| InChI | InChI=1S/C19H28O6/c1-2-3-6-13(20)9-10-15-16(18(23)12-17(15)22)11-14(21)7-4-5-8-19(24)25/h5,8-10,13,15-17,20,22H,2-4,6-7,11-12H2,1H3,(H,24,25)/t13?,15-,16-,17?/m1/s1 |
| InChIKey | MVJRGRZVVJNXNX-JCUPBUFNSA-N |
| XLogP | 2.04 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|