C24H39NO6S — CID 70517594
(Z)-7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxy-3-(3-propylcyclopentyl)prop-1-enyl]-3-oxocyclopentyl]-N-methylsulfonylhept-5-enamide (PubChem CID 70517594) has the molecular formula C24H39NO6S and a molecular weight of 469.64 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxy-3-(3-propylcyclopentyl)prop-1-enyl]-3-oxocyclopentyl]-N-methylsulfonylhept-5-enamide.
| Compound Name | (Z)-7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxy-3-(3-propylcyclopentyl)prop-1-enyl]-3-oxocyclopentyl]-N-methylsulfonylhept-5-enamide |
|---|---|
| PubChem CID | 70517594 |
| Molecular Formula | C24H39NO6S |
| Molecular Weight | 469.64 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | (Z)-7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxy-3-(3-propylcyclopentyl)prop-1-enyl]-3-oxocyclopentyl]-N-methylsulfonylhept-5-enamide |
| SMILES | CCCC1CCC([C@H](O)/C=C/[C@H]2C(=O)C[C@H](O)[C@@H]2C/C=C\CCCC(=O)NS(C)(=O)=O)C1 |
| InChI | InChI=1S/C24H39NO6S/c1-3-8-17-11-12-18(15-17)21(26)14-13-20-19(22(27)16-23(20)28)9-6-4-5-7-10-24(29)25-32(2,30)31/h4,6,13-14,17-22,26-27H,3,5,7-12,15-16H2,1-2H3,(H,25,29)/b6-4-,14-13+/t17?,18?,19-,20-,21-,22+/m1/s1 |
| InChIKey | PBLQCBVYYKTIPL-VFZFRXFJSA-N |
| XLogP | 2.88 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.64 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|