C24H34N2O6S — CID 58654679
(Z)-7-[(1R,2R,3Z,5S)-5-hydroxy-3-hydroxyimino-2-[(E)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]-N-methylsulfonylhept-5-enamide (PubChem CID 58654679) has the molecular formula C24H34N2O6S and a molecular weight of 478.61 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3Z,5S)-5-hydroxy-3-hydroxyimino-2-[(E)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]-N-methylsulfonylhept-5-enamide.
| Compound Name | (Z)-7-[(1R,2R,3Z,5S)-5-hydroxy-3-hydroxyimino-2-[(E)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]-N-methylsulfonylhept-5-enamide |
|---|---|
| PubChem CID | 58654679 |
| Molecular Formula | C24H34N2O6S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | (Z)-7-[(1R,2R,3Z,5S)-5-hydroxy-3-hydroxyimino-2-[(E)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]-N-methylsulfonylhept-5-enamide |
| SMILES | CS(=O)(=O)NC(=O)CCC/C=C\C[C@H]1[C@@H](O)C/C(=N/O)[C@@H]1/C=C/C(O)CCc1ccccc1 |
| InChI | InChI=1S/C24H34N2O6S/c1-33(31,32)26-24(29)12-8-3-2-7-11-21-20(22(25-30)17-23(21)28)16-15-19(27)14-13-18-9-5-4-6-10-18/h2,4-7,9-10,15-16,19-21,23,27-28,30H,3,8,11-14,17H2,1H3,(H,26,29)/b7-2-,16-15+,25-22-/t19?,20-,21-,23+/m1/s1 |
| InChIKey | ATNQCYWJIDALAE-HLFAGRCKSA-N |
| XLogP | 2.56 |
| TPSA | 136.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|