C25H33NO3 — CID 45137094
(Z)-N-ethyl-7-[(1S,5R)-5-[(E,3R)-3-hydroxy-5-phenylpent-1-enyl]-4-oxocyclopent-2-en-1-yl]hept-5-enamide (PubChem CID 45137094) has the molecular formula C25H33NO3 and a molecular weight of 395.54 g/mol. Its IUPAC name is (Z)-N-ethyl-7-[(1S,5R)-5-[(E,3R)-3-hydroxy-5-phenylpent-1-enyl]-4-oxocyclopent-2-en-1-yl]hept-5-enamide.
| Compound Name | (Z)-N-ethyl-7-[(1S,5R)-5-[(E,3R)-3-hydroxy-5-phenylpent-1-enyl]-4-oxocyclopent-2-en-1-yl]hept-5-enamide |
|---|---|
| PubChem CID | 45137094 |
| Molecular Formula | C25H33NO3 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | (Z)-N-ethyl-7-[(1S,5R)-5-[(E,3R)-3-hydroxy-5-phenylpent-1-enyl]-4-oxocyclopent-2-en-1-yl]hept-5-enamide |
| SMILES | CCNC(=O)CCC/C=C\C[C@H]1C=CC(=O)[C@@H]1/C=C/[C@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C25H33NO3/c1-2-26-25(29)13-9-4-3-8-12-21-15-19-24(28)23(21)18-17-22(27)16-14-20-10-6-5-7-11-20/h3,5-8,10-11,15,17-19,21-23,27H,2,4,9,12-14,16H2,1H3,(H,26,29)/b8-3-,18-17+/t21-,22+,23+/m0/s1 |
| InChIKey | VFFAQPWMJATGMU-GVGUXBOPSA-N |
| XLogP | 4.16 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|