C22H30O4 — CID 131840718
(E,4R)-4-hydroxy-6-[(1S,5S)-2-oxo-5-[(2Z,5Z,8Z)-undeca-2,5,8-trienyl]cyclopent-3-en-1-yl]hex-5-enoic acid (PubChem CID 131840718) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is (E,4R)-4-hydroxy-6-[(1S,5S)-2-oxo-5-[(2Z,5Z,8Z)-undeca-2,5,8-trienyl]cyclopent-3-en-1-yl]hex-5-enoic acid.
| Compound Name | (E,4R)-4-hydroxy-6-[(1S,5S)-2-oxo-5-[(2Z,5Z,8Z)-undeca-2,5,8-trienyl]cyclopent-3-en-1-yl]hex-5-enoic acid |
|---|---|
| PubChem CID | 131840718 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (E,4R)-4-hydroxy-6-[(1S,5S)-2-oxo-5-[(2Z,5Z,8Z)-undeca-2,5,8-trienyl]cyclopent-3-en-1-yl]hex-5-enoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C[C@H]1C=CC(=O)[C@H]1/C=C/[C@H](O)CCC(=O)O |
| InChI | InChI=1S/C22H30O4/c1-2-3-4-5-6-7-8-9-10-11-18-12-16-21(24)20(18)15-13-19(23)14-17-22(25)26/h3-4,6-7,9-10,12-13,15-16,18-20,23H,2,5,8,11,14,17H2,1H3,(H,25,26)/b4-3-,7-6-,10-9-,15-13+/t18-,19-,20-/m0/s1 |
| InChIKey | UBHADOIVPSTTIO-OIXQRLCASA-N |
| XLogP | 4.39 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|