C22H32O4 — CID 56618961
7-[(1S,5R)-5-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-4-oxocyclopent-2-en-1-yl]hepta-2,5-dienoic acid (PubChem CID 56618961) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is 7-[(1S,5R)-5-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-4-oxocyclopent-2-en-1-yl]hepta-2,5-dienoic acid.
| Compound Name | 7-[(1S,5R)-5-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-4-oxocyclopent-2-en-1-yl]hepta-2,5-dienoic acid |
|---|---|
| PubChem CID | 56618961 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 7-[(1S,5R)-5-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-4-oxocyclopent-2-en-1-yl]hepta-2,5-dienoic acid |
| SMILES | CCCC[C@H](C)C[C@H](O)C=C[C@H]1C(=O)C=C[C@@H]1CC=CCC=CC(=O)O |
| InChI | InChI=1S/C22H32O4/c1-3-4-9-17(2)16-19(23)13-14-20-18(12-15-21(20)24)10-7-5-6-8-11-22(25)26/h5,7-8,11-15,17-20,23H,3-4,6,9-10,16H2,1-2H3,(H,25,26)/t17-,18-,19+,20+/m0/s1 |
| InChIKey | KZMZMKYEIRKJHH-VNTMZGSJSA-N |
| XLogP | 4.47 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|