C23H37NO5S — CID 70517942
(Z)-7-[(1S,5R)-5-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-4-oxocyclopent-2-en-1-yl]-N-methylsulfonylhept-5-enamide (PubChem CID 70517942) has the molecular formula C23H37NO5S and a molecular weight of 439.62 g/mol. Its IUPAC name is (Z)-7-[(1S,5R)-5-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-4-oxocyclopent-2-en-1-yl]-N-methylsulfonylhept-5-enamide.
| Compound Name | (Z)-7-[(1S,5R)-5-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-4-oxocyclopent-2-en-1-yl]-N-methylsulfonylhept-5-enamide |
|---|---|
| PubChem CID | 70517942 |
| Molecular Formula | C23H37NO5S |
| Molecular Weight | 439.62 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | (Z)-7-[(1S,5R)-5-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-4-oxocyclopent-2-en-1-yl]-N-methylsulfonylhept-5-enamide |
| SMILES | CCCC[C@H](C)C[C@H](O)/C=C/[C@H]1C(=O)C=C[C@@H]1C/C=C\CCCC(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C23H37NO5S/c1-4-5-10-18(2)17-20(25)14-15-21-19(13-16-22(21)26)11-8-6-7-9-12-23(27)24-30(3,28)29/h6,8,13-16,18-21,25H,4-5,7,9-12,17H2,1-3H3,(H,24,27)/b8-6-,15-14+/t18-,19-,20+,21+/m0/s1 |
| InChIKey | IPUHUPQMDLLTDF-RPIPSEEUSA-N |
| XLogP | 3.68 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.62 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|