C29H44BNO4 — CID 58231631
(Z)-7-[(6R,7R)-3-butyl-7-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]-2,4-dioxa-3-borabicyclo[3.2.1]octan-6-yl]-N-ethylhept-5-enamide (PubChem CID 58231631) has the molecular formula C29H44BNO4 and a molecular weight of 481.49 g/mol. Its IUPAC name is (Z)-7-[(6R,7R)-3-butyl-7-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]-2,4-dioxa-3-borabicyclo[3.2.1]octan-6-yl]-N-ethylhept-5-enamide.
| Compound Name | (Z)-7-[(6R,7R)-3-butyl-7-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]-2,4-dioxa-3-borabicyclo[3.2.1]octan-6-yl]-N-ethylhept-5-enamide |
|---|---|
| PubChem CID | 58231631 |
| Molecular Formula | C29H44BNO4 |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 481.34 |
| IUPAC Name | (Z)-7-[(6R,7R)-3-butyl-7-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]-2,4-dioxa-3-borabicyclo[3.2.1]octan-6-yl]-N-ethylhept-5-enamide |
| SMILES | CCCCB1OC2CC(O1)[C@H](C/C=C\CCCC(=O)NCC)[C@H]2/C=C/[C@@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C29H44BNO4/c1-3-5-21-30-34-27-22-28(35-30)26(20-19-24(32)18-17-23-13-9-8-10-14-23)25(27)15-11-6-7-12-16-29(33)31-4-2/h6,8-11,13-14,19-20,24-28,32H,3-5,7,12,15-18,21-22H2,1-2H3,(H,31,33)/b11-6-,20-19+/t24-,25+,26+,27?,28?/m0/s1 |
| InChIKey | QATHOUBWHVOXNE-KTRLQKTQSA-N |
| XLogP | 5.50 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|