C41H62BBr2NO6 — CID 66692966
[(E)-1-[7-[(Z)-7-[6-bromohexanoyl(ethyl)amino]-7-oxohept-2-enyl]-3-butyl-2,4-dioxa-3-borabicyclo[3.2.1]octan-6-yl]-5-phenylpent-1-en-3-yl] 6-bromohexanoate (PubChem CID 66692966) has the molecular formula C41H62BBr2NO6 and a molecular weight of 835.57 g/mol. Its IUPAC name is [(E)-1-[7-[(Z)-7-[6-bromohexanoyl(ethyl)amino]-7-oxohept-2-enyl]-3-butyl-2,4-dioxa-3-borabicyclo[3.2.1]octan-6-yl]-5-phenylpent-1-en-3-yl] 6-bromohexanoate.
| Compound Name | [(E)-1-[7-[(Z)-7-[6-bromohexanoyl(ethyl)amino]-7-oxohept-2-enyl]-3-butyl-2,4-dioxa-3-borabicyclo[3.2.1]octan-6-yl]-5-phenylpent-1-en-3-yl] 6-bromohexanoate |
|---|---|
| PubChem CID | 66692966 |
| Molecular Formula | C41H62BBr2NO6 |
| Molecular Weight | 835.57 g/mol |
| Exact Mass | 833.30 |
| IUPAC Name | [(E)-1-[7-[(Z)-7-[6-bromohexanoyl(ethyl)amino]-7-oxohept-2-enyl]-3-butyl-2,4-dioxa-3-borabicyclo[3.2.1]octan-6-yl]-5-phenylpent-1-en-3-yl] 6-bromohexanoate |
| SMILES | CCCCB1OC2CC(O1)C(C/C=C\CCCC(=O)N(CC)C(=O)CCCCCBr)C2/C=C/C(CCc1ccccc1)OC(=O)CCCCCBr |
| InChI | InChI=1S/C41H62BBr2NO6/c1-3-5-29-42-50-37-32-38(51-42)36(28-27-34(26-25-33-19-11-8-12-20-33)49-41(48)24-16-10-18-31-44)35(37)21-13-6-7-14-22-39(46)45(4-2)40(47)23-15-9-17-30-43/h6,8,11-13,19-20,27-28,34-38H,3-5,7,9-10,14-18,21-26,29-32H2,1-2H3/b13-6-,28-27+ |
| InChIKey | JGDOEGQBCFMHBZ-IPDCEKFJSA-N |
| XLogP | 10.20 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.57 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|