C19H31NO3 — CID 142089775
(1S,2R,3R,4Z)-2-[(Z)-hex-2-enyl]-4-hydroxyimino-3-[(1E,5E)-3-hydroxyocta-1,5-dienyl]cyclopentan-1-ol (PubChem CID 142089775) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is (1S,2R,3R,4Z)-2-[(Z)-hex-2-enyl]-4-hydroxyimino-3-[(1E,5E)-3-hydroxyocta-1,5-dienyl]cyclopentan-1-ol.
| Compound Name | (1S,2R,3R,4Z)-2-[(Z)-hex-2-enyl]-4-hydroxyimino-3-[(1E,5E)-3-hydroxyocta-1,5-dienyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 142089775 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | (1S,2R,3R,4Z)-2-[(Z)-hex-2-enyl]-4-hydroxyimino-3-[(1E,5E)-3-hydroxyocta-1,5-dienyl]cyclopentan-1-ol |
| SMILES | CC/C=C/CC(O)/C=C/[C@H]1/C(=N\O)C[C@H](O)[C@@H]1C/C=C\CCC |
| InChI | InChI=1S/C19H31NO3/c1-3-5-7-9-11-17-16(18(20-23)14-19(17)22)13-12-15(21)10-8-6-4-2/h6-9,12-13,15-17,19,21-23H,3-5,10-11,14H2,1-2H3/b8-6+,9-7-,13-12+,20-18-/t15?,16-,17-,19+/m1/s1 |
| InChIKey | AJDPKUXNHPFNFQ-JSULVZTHSA-N |
| XLogP | 3.83 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|