C16H29NO3 — CID 142089766
(1S,2R,3R,4Z)-4-hydroxyimino-3-[(E)-3-hydroxyoct-1-enyl]-2-propylcyclopentan-1-ol (PubChem CID 142089766) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is (1S,2R,3R,4Z)-4-hydroxyimino-3-[(E)-3-hydroxyoct-1-enyl]-2-propylcyclopentan-1-ol.
| Compound Name | (1S,2R,3R,4Z)-4-hydroxyimino-3-[(E)-3-hydroxyoct-1-enyl]-2-propylcyclopentan-1-ol |
|---|---|
| PubChem CID | 142089766 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | (1S,2R,3R,4Z)-4-hydroxyimino-3-[(E)-3-hydroxyoct-1-enyl]-2-propylcyclopentan-1-ol |
| SMILES | CCCCCC(O)/C=C/[C@H]1/C(=N\O)C[C@H](O)[C@@H]1CCC |
| InChI | InChI=1S/C16H29NO3/c1-3-5-6-8-12(18)9-10-13-14(7-4-2)16(19)11-15(13)17-20/h9-10,12-14,16,18-20H,3-8,11H2,1-2H3/b10-9+,17-15-/t12?,13-,14-,16+/m1/s1 |
| InChIKey | GLRSUFCACXJVLK-XVCBZJDOSA-N |
| XLogP | 3.11 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|