C26H37NO5 — CID 22085170
(E)-7-[(3Z)-2-[(E)-3-ethyl-3-hydroxy-6-phenylhex-1-enyl]-5-hydroxy-3-hydroxyiminocyclopentyl]hept-5-enoic acid (PubChem CID 22085170) has the molecular formula C26H37NO5 and a molecular weight of 443.58 g/mol. Its IUPAC name is (E)-7-[(3Z)-2-[(E)-3-ethyl-3-hydroxy-6-phenylhex-1-enyl]-5-hydroxy-3-hydroxyiminocyclopentyl]hept-5-enoic acid.
| Compound Name | (E)-7-[(3Z)-2-[(E)-3-ethyl-3-hydroxy-6-phenylhex-1-enyl]-5-hydroxy-3-hydroxyiminocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 22085170 |
| Molecular Formula | C26H37NO5 |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | (E)-7-[(3Z)-2-[(E)-3-ethyl-3-hydroxy-6-phenylhex-1-enyl]-5-hydroxy-3-hydroxyiminocyclopentyl]hept-5-enoic acid |
| SMILES | CCC(O)(/C=C/C1/C(=N\O)CC(O)C1C/C=C/CCCC(=O)O)CCCc1ccccc1 |
| InChI | InChI=1S/C26H37NO5/c1-2-26(31,17-10-13-20-11-6-5-7-12-20)18-16-21-22(24(28)19-23(21)27-32)14-8-3-4-9-15-25(29)30/h3,5-8,11-12,16,18,21-22,24,28,31-32H,2,4,9-10,13-15,17,19H2,1H3,(H,29,30)/b8-3+,18-16+,27-23- |
| InChIKey | PIFGJZGGWCXHHH-DQGALJPQSA-N |
| XLogP | 4.74 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|