C28H46O6 — CID 70512039
(Z)-7-[(1R,2R,5S)-3,5-dihydroxy-2-[(E)-3-(oxan-2-yloxy)-3-(3-propylcyclopentyl)prop-1-enyl]cyclopentyl]hept-5-enoic acid (PubChem CID 70512039) has the molecular formula C28H46O6 and a molecular weight of 478.67 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,5S)-3,5-dihydroxy-2-[(E)-3-(oxan-2-yloxy)-3-(3-propylcyclopentyl)prop-1-enyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,5S)-3,5-dihydroxy-2-[(E)-3-(oxan-2-yloxy)-3-(3-propylcyclopentyl)prop-1-enyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70512039 |
| Molecular Formula | C28H46O6 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | (Z)-7-[(1R,2R,5S)-3,5-dihydroxy-2-[(E)-3-(oxan-2-yloxy)-3-(3-propylcyclopentyl)prop-1-enyl]cyclopentyl]hept-5-enoic acid |
| SMILES | CCCC1CCC(C(/C=C/[C@H]2C(O)C[C@H](O)[C@@H]2C/C=C\CCCC(=O)O)OC2CCCCO2)C1 |
| InChI | InChI=1S/C28H46O6/c1-2-9-20-13-14-21(18-20)26(34-28-12-7-8-17-33-28)16-15-23-22(24(29)19-25(23)30)10-5-3-4-6-11-27(31)32/h3,5,15-16,20-26,28-30H,2,4,6-14,17-19H2,1H3,(H,31,32)/b5-3-,16-15+/t20?,21?,22-,23-,24+,25?,26?,28?/m1/s1 |
| InChIKey | NRSQHFSFKZWPKG-HSSJHDDVSA-N |
| XLogP | 5.23 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|