C37H67FO9Si — CID 172836774
[2-[(1R,2R,3R,5S)-2-[(E)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]-1-hydroxyethyl] 2-fluoro-6-hydroxyhexanoate (PubChem CID 172836774) has the molecular formula C37H67FO9Si and a molecular weight of 703.02 g/mol. Its IUPAC name is [2-[(1R,2R,3R,5S)-2-[(E)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]-1-hydroxyethyl] 2-fluoro-6-hydroxyhexanoate.
| Compound Name | [2-[(1R,2R,3R,5S)-2-[(E)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]-1-hydroxyethyl] 2-fluoro-6-hydroxyhexanoate |
|---|---|
| PubChem CID | 172836774 |
| Molecular Formula | C37H67FO9Si |
| Molecular Weight | 703.02 g/mol |
| Exact Mass | 702.45 |
| IUPAC Name | [2-[(1R,2R,3R,5S)-2-[(E)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]-1-hydroxyethyl] 2-fluoro-6-hydroxyhexanoate |
| SMILES | CCCCCC(/C=C/[C@@H]1[C@@H](CC(O)OC(=O)C(F)CCCCO)[C@@H](OC2CCCCO2)C[C@H]1OC1CCCCO1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H67FO9Si/c1-7-8-9-16-27(47-48(5,6)37(2,3)4)20-21-28-29(25-33(40)46-36(41)30(38)17-10-13-22-39)32(45-35-19-12-15-24-43-35)26-31(28)44-34-18-11-14-23-42-34/h20-21,27-35,39-40H,7-19,22-26H2,1-6H3/b21-20+/t27?,28-,29-,30?,31-,32+,33?,34?,35?/m1/s1 |
| InChIKey | WGGBMWJJKGFZAP-CULGGLEGSA-N |
| XLogP | 7.73 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.02 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|