C34H47F3O7 — CID 91276620
2-[(2R)-4-[(1R,2R,3S,5R)-3,5-bis(oxan-2-yloxy)-2-prop-2-enylcyclopentyl]-1-[3-(trifluoromethyl)phenoxy]but-3-en-2-yl]oxyoxane (PubChem CID 91276620) has the molecular formula C34H47F3O7 and a molecular weight of 624.74 g/mol. Its IUPAC name is 2-[(2R)-4-[(1R,2R,3S,5R)-3,5-bis(oxan-2-yloxy)-2-prop-2-enylcyclopentyl]-1-[3-(trifluoromethyl)phenoxy]but-3-en-2-yl]oxyoxane.
| Compound Name | 2-[(2R)-4-[(1R,2R,3S,5R)-3,5-bis(oxan-2-yloxy)-2-prop-2-enylcyclopentyl]-1-[3-(trifluoromethyl)phenoxy]but-3-en-2-yl]oxyoxane |
|---|---|
| PubChem CID | 91276620 |
| Molecular Formula | C34H47F3O7 |
| Molecular Weight | 624.74 g/mol |
| Exact Mass | 624.33 |
| IUPAC Name | 2-[(2R)-4-[(1R,2R,3S,5R)-3,5-bis(oxan-2-yloxy)-2-prop-2-enylcyclopentyl]-1-[3-(trifluoromethyl)phenoxy]but-3-en-2-yl]oxyoxane |
| SMILES | C=CC[C@@H]1[C@@H](C=C[C@H](COc2cccc(C(F)(F)F)c2)OC2CCCCO2)[C@H](OC2CCCCO2)C[C@@H]1OC1CCCCO1 |
| InChI | InChI=1S/C34H47F3O7/c1-2-10-27-28(30(44-33-15-5-8-20-40-33)22-29(27)43-32-14-4-7-19-39-32)17-16-26(42-31-13-3-6-18-38-31)23-41-25-12-9-11-24(21-25)34(35,36)37/h2,9,11-12,16-17,21,26-33H,1,3-8,10,13-15,18-20,22-23H2/t26-,27-,28-,29+,30-,31?,32?,33?/m1/s1 |
| InChIKey | NUSJWRWGZKZWRR-FGIALNMJSA-N |
| XLogP | 7.59 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.74 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|