C35H57BrO7 — CID 70470508
(2R,3aR,4R,5R,6aR)-2-[1-bromo-5-(oxan-2-yloxy)pentyl]-4-[(3S)-3-cyclopentyl-3-(oxan-2-yloxy)prop-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan (PubChem CID 70470508) has the molecular formula C35H57BrO7 and a molecular weight of 669.74 g/mol. Its IUPAC name is (2R,3aR,4R,5R,6aR)-2-[1-bromo-5-(oxan-2-yloxy)pentyl]-4-[(3S)-3-cyclopentyl-3-(oxan-2-yloxy)prop-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan.
| Compound Name | (2R,3aR,4R,5R,6aR)-2-[1-bromo-5-(oxan-2-yloxy)pentyl]-4-[(3S)-3-cyclopentyl-3-(oxan-2-yloxy)prop-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan |
|---|---|
| PubChem CID | 70470508 |
| Molecular Formula | C35H57BrO7 |
| Molecular Weight | 669.74 g/mol |
| Exact Mass | 668.33 |
| IUPAC Name | (2R,3aR,4R,5R,6aR)-2-[1-bromo-5-(oxan-2-yloxy)pentyl]-4-[(3S)-3-cyclopentyl-3-(oxan-2-yloxy)prop-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan |
| SMILES | BrC(CCCCOC1CCCCO1)[C@H]1C[C@@H]2[C@@H](C=C[C@@H](OC3CCCCO3)C3CCCC3)[C@H](OC3CCCCO3)C[C@H]2O1 |
| InChI | InChI=1S/C35H57BrO7/c36-28(13-3-7-19-37-33-14-4-8-20-38-33)32-23-27-26(30(24-31(27)41-32)43-35-16-6-10-22-40-35)17-18-29(25-11-1-2-12-25)42-34-15-5-9-21-39-34/h17-18,25-35H,1-16,19-24H2/t26-,27-,28?,29-,30-,31-,32-,33?,34?,35?/m1/s1 |
| InChIKey | MDFCCJJFWSCZDI-OWUNLAGBSA-N |
| XLogP | 7.83 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.74 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|