C40H76N2O6 — CID 101011145
(1R)-1-[(2R,5R)-5-[(2R,5R)-5-[(1R)-1-amino-11-(oxan-2-yloxy)undecyl]oxolan-2-yl]oxolan-2-yl]-11-(oxan-2-yloxy)undecan-1-amine (PubChem CID 101011145) has the molecular formula C40H76N2O6 and a molecular weight of 681.06 g/mol. Its IUPAC name is (1R)-1-[(2R,5R)-5-[(2R,5R)-5-[(1R)-1-amino-11-(oxan-2-yloxy)undecyl]oxolan-2-yl]oxolan-2-yl]-11-(oxan-2-yloxy)undecan-1-amine.
| Compound Name | (1R)-1-[(2R,5R)-5-[(2R,5R)-5-[(1R)-1-amino-11-(oxan-2-yloxy)undecyl]oxolan-2-yl]oxolan-2-yl]-11-(oxan-2-yloxy)undecan-1-amine |
|---|---|
| PubChem CID | 101011145 |
| Molecular Formula | C40H76N2O6 |
| Molecular Weight | 681.06 g/mol |
| Exact Mass | 680.57 |
| IUPAC Name | (1R)-1-[(2R,5R)-5-[(2R,5R)-5-[(1R)-1-amino-11-(oxan-2-yloxy)undecyl]oxolan-2-yl]oxolan-2-yl]-11-(oxan-2-yloxy)undecan-1-amine |
| SMILES | N[C@H](CCCCCCCCCCOC1CCCCO1)[C@H]1CC[C@H]([C@H]2CC[C@H]([C@H](N)CCCCCCCCCCOC3CCCCO3)O2)O1 |
| InChI | InChI=1S/C40H76N2O6/c41-33(21-13-9-5-1-3-7-11-17-29-43-39-23-15-19-31-45-39)35-25-27-37(47-35)38-28-26-36(48-38)34(42)22-14-10-6-2-4-8-12-18-30-44-40-24-16-20-32-46-40/h33-40H,1-32,41-42H2/t33-,34-,35-,36-,37-,38-,39?,40?/m1/s1 |
| InChIKey | DLARBWGBKHKUMX-XIRJABQDSA-N |
| XLogP | 8.84 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.06 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|