C15H27IO2 — CID 88618382
2-[(E)-1-iodo-5,5-dimethyloct-1-enoxy]oxane (PubChem CID 88618382) has the molecular formula C15H27IO2 and a molecular weight of 366.28 g/mol. Its IUPAC name is 2-[(E)-1-iodo-5,5-dimethyloct-1-enoxy]oxane.
| Compound Name | 2-[(E)-1-iodo-5,5-dimethyloct-1-enoxy]oxane |
|---|---|
| PubChem CID | 88618382 |
| Molecular Formula | C15H27IO2 |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 2-[(E)-1-iodo-5,5-dimethyloct-1-enoxy]oxane |
| SMILES | CCCC(C)(C)CC/C=C(/I)OC1CCCCO1 |
| InChI | InChI=1S/C15H27IO2/c1-4-10-15(2,3)11-7-8-13(16)18-14-9-5-6-12-17-14/h8,14H,4-7,9-12H2,1-3H3/b13-8- |
| InChIKey | KVKYJDOPDQUZKA-JYRVWZFOSA-N |
| XLogP | 5.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|