C36H55BrO6Si — CID 56980880
[(1S,2R,3S,4S)-2-[(2S)-2-bromobut-3-ynyl]-4-(oxan-2-yloxy)-3-[3-(oxan-2-yloxy)-5-phenoxypent-2-en-2-yl]cyclopentyl]oxy-tert-butyl-dimethylsilane (PubChem CID 56980880) has the molecular formula C36H55BrO6Si and a molecular weight of 691.82 g/mol. Its IUPAC name is [(1S,2R,3S,4S)-2-[(2S)-2-bromobut-3-ynyl]-4-(oxan-2-yloxy)-3-[3-(oxan-2-yloxy)-5-phenoxypent-2-en-2-yl]cyclopentyl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,2R,3S,4S)-2-[(2S)-2-bromobut-3-ynyl]-4-(oxan-2-yloxy)-3-[3-(oxan-2-yloxy)-5-phenoxypent-2-en-2-yl]cyclopentyl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 56980880 |
| Molecular Formula | C36H55BrO6Si |
| Molecular Weight | 691.82 g/mol |
| Exact Mass | 690.30 |
| IUPAC Name | [(1S,2R,3S,4S)-2-[(2S)-2-bromobut-3-ynyl]-4-(oxan-2-yloxy)-3-[3-(oxan-2-yloxy)-5-phenoxypent-2-en-2-yl]cyclopentyl]oxy-tert-butyl-dimethylsilane |
| SMILES | C#C[C@@H](Br)C[C@@H]1[C@@H](C(C)=C(CCOc2ccccc2)OC2CCCCO2)[C@@H](OC2CCCCO2)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H55BrO6Si/c1-8-27(37)24-29-31(43-44(6,7)36(3,4)5)25-32(42-34-19-13-15-22-40-34)35(29)26(2)30(41-33-18-12-14-21-39-33)20-23-38-28-16-10-9-11-17-28/h1,9-11,16-17,27,29,31-35H,12-15,18-25H2,2-7H3/t27-,29+,31+,32+,33?,34?,35-/m1/s1 |
| InChIKey | XYAILFCCYXYZSB-SZXVBANUSA-N |
| XLogP | 9.00 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.82 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|