C35H53IO6Si — CID 56978905
tert-butyl-[(1R,2S,3S,4S)-2-[(2S)-2-iodobut-3-ynyl]-4-(oxan-2-yloxy)-3-[1-(oxan-2-yloxy)-4-phenoxybut-1-enyl]cyclopentyl]oxy-dimethylsilane (PubChem CID 56978905) has the molecular formula C35H53IO6Si and a molecular weight of 724.79 g/mol. Its IUPAC name is tert-butyl-[(1R,2S,3S,4S)-2-[(2S)-2-iodobut-3-ynyl]-4-(oxan-2-yloxy)-3-[1-(oxan-2-yloxy)-4-phenoxybut-1-enyl]cyclopentyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1R,2S,3S,4S)-2-[(2S)-2-iodobut-3-ynyl]-4-(oxan-2-yloxy)-3-[1-(oxan-2-yloxy)-4-phenoxybut-1-enyl]cyclopentyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 56978905 |
| Molecular Formula | C35H53IO6Si |
| Molecular Weight | 724.79 g/mol |
| Exact Mass | 724.27 |
| IUPAC Name | tert-butyl-[(1R,2S,3S,4S)-2-[(2S)-2-iodobut-3-ynyl]-4-(oxan-2-yloxy)-3-[1-(oxan-2-yloxy)-4-phenoxybut-1-enyl]cyclopentyl]oxy-dimethylsilane |
| SMILES | C#C[C@@H](I)C[C@H]1[C@H](C(=CCCOc2ccccc2)OC2CCCCO2)[C@@H](OC2CCCCO2)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H53IO6Si/c1-7-26(36)24-28-30(42-43(5,6)35(2,3)4)25-31(41-33-20-12-14-22-39-33)34(28)29(40-32-19-11-13-21-38-32)18-15-23-37-27-16-9-8-10-17-27/h1,8-10,16-18,26,28,30-34H,11-15,19-25H2,2-6H3/t26-,28-,30-,31+,32?,33?,34-/m1/s1 |
| InChIKey | VCVQPGDJQBHIQA-SHLGVIEZSA-N |
| XLogP | 8.65 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.79 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|