C22H32O6 — CID 70192074
(Z)-7-[2-[(E)-5-(furan-2-yl)-1-methoxypent-1-enyl]-1,2-dihydroxycyclopentyl]hept-5-enoic acid (PubChem CID 70192074) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is (Z)-7-[2-[(E)-5-(furan-2-yl)-1-methoxypent-1-enyl]-1,2-dihydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[2-[(E)-5-(furan-2-yl)-1-methoxypent-1-enyl]-1,2-dihydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70192074 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | (Z)-7-[2-[(E)-5-(furan-2-yl)-1-methoxypent-1-enyl]-1,2-dihydroxycyclopentyl]hept-5-enoic acid |
| SMILES | CO/C(=C/CCCc1ccco1)C1(O)CCCC1(O)C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C22H32O6/c1-27-19(12-6-5-10-18-11-8-17-28-18)22(26)16-9-15-21(22,25)14-7-3-2-4-13-20(23)24/h3,7-8,11-12,17,25-26H,2,4-6,9-10,13-16H2,1H3,(H,23,24)/b7-3-,19-12+ |
| InChIKey | UCWSSSRYRGQOKV-FZFSQPPVSA-N |
| XLogP | 3.98 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|